CAS 1821820-77-2 is the registry number for (R)-2,2,2-Trifluoro-1-(tetrahydro-2H-pyran-4-yl)ethanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
(1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine;hydrochloride (CAS 1821820-77-2) is a chemical compound with the molecular formula C7H13ClF3NO and a molecular weight of 219.63 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine;hydrochloride. InChIKey: MBDMWPLGAFDSKZ-FYZOBXCZSA-N.
| Molecular formula | C7H13ClF3NO |
|---|---|
| Molecular weight | 219.63 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethanamine;hydrochloride |
| InChIKey | MBDMWPLGAFDSKZ-FYZOBXCZSA-N |
| SMILES | C1COCCC1[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)