Products 1632286-19-1

CAS 1632286-19-1 appears in our catalog under these names: 2,5-Diaza-bicyclo[2.2.2]octane-2,5-dicarboxylic acid di-tert-butyl ester, 95%, Di-tert-butyl 2,5-diazabicyclo(2.2.2)octane-2,5-dicarboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ditert-butyl 2,5-diazabicyclo[2.2.2]octane-2,5-dicarboxylate (CAS 1632286-19-1) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: ditert-butyl 2,5-diazabicyclo[2.2.2]octane-2,5-dicarboxylate. InChIKey: ABGGQKOQAMWLHU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28N2O4
Molecular weight312.40 g/mol
IUPAC nameditert-butyl 2,5-diazabicyclo[2.2.2]octane-2,5-dicarboxylate
InChIKeyABGGQKOQAMWLHU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2CCC1CN2C(=O)OC(C)(C)C

Computed by PubChem (NCBI)