CAS 203934-60-5 appears in our catalog under these names: 2,8-Diazaspiro[4.5]decane-3,8-dicarboxylic acid 8-tert-butyl ester 3-ethyl ester, 95%, 8-tert-Butyl 3-ethyl 2,8-diazaspiro(4.5)decane-3,8-dicarboxylate, 97%, 8–tert–Butyl 3–ethyl 2,8–diazaspiro(4·5)decane–3,8–dicarboxylate, 8-tert-Butyl 3-ethyl 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate 95%, 2,8-Diazaspiro[4.5]decane-3,8-dicarboxylic acid, 8-(1,1-dimethylethyl) 3-ethyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g.
8-O-tert-butyl 3-O-ethyl 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate (CAS 203934-60-5) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: 8-O-tert-butyl 3-O-ethyl 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate. InChIKey: WXRWBESBLVCYGR-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-ethyl 2,8-diazaspiro[4.5]decane-3,8-dicarboxylate |
| InChIKey | WXRWBESBLVCYGR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2(CCN(CC2)C(=O)OC(C)(C)C)CN1 |
Computed by PubChem (NCBI)