CAS 1523571-81-4 appears in our catalog under these names: 6–Aza–spiro(3·4)octane oxalate, 6-Azaspiro[3.4]octane hemioxalate, 95%, 6-Azaspiro(3.4)octane oxalate(2:1), 97%, 6-Azaspiro[3.4]octane oxalate(2:1), 97%, 97%, 6-AZASPIRO[3.4]OCTANE HEMIOXALATE, 97%. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
Bis(6-azaspiro[3.4]octane);oxalic acid (CAS 1523571-81-4) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: bis(6-azaspiro[3.4]octane);oxalic acid. InChIKey: JILKQWFQRJNDCW-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | bis(6-azaspiro[3.4]octane);oxalic acid |
| InChIKey | JILKQWFQRJNDCW-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CCNC2.C1CC2(C1)CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)