CAS 1523617-94-8 appears in our catalog under these names: 2-Azaspiro[3.4]octane hemioxalate, 95%, 2-Azaspiro(3.4)octane oxalate(2:1), 97%, 2-azaspiro[3.4]octane hemioxalate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg.
Bis(2-azaspiro[3.4]octane);oxalic acid (CAS 1523617-94-8) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: bis(2-azaspiro[3.4]octane);oxalic acid. InChIKey: ZFBQBCHFEOUKDG-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | bis(2-azaspiro[3.4]octane);oxalic acid |
| InChIKey | ZFBQBCHFEOUKDG-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CNC2.C1CCC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)