CAS 1822663-31-9 is the registry number for Methyl 6-fluorochromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-fluoro-3,4-dihydro-2H-chromene-3-carboxylate (CAS 1822663-31-9) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: methyl 6-fluoro-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: HHFDZEJUSAWSGQ-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | methyl 6-fluoro-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | HHFDZEJUSAWSGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C=CC(=C2)F)OC1 |
Computed by PubChem (NCBI)