Products 1822687-86-4

CAS 1822687-86-4 is the registry number for methyl 5-nitro-6-oxo-5,6-dihydropyridine-3-carboxylate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-nitro-2-oxo-3H-pyridine-5-carboxylate (CAS 1822687-86-4) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: methyl 3-nitro-2-oxo-3H-pyridine-5-carboxylate. InChIKey: LAZDEVARJMTZEO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O5
Molecular weight198.13 g/mol
IUPAC namemethyl 3-nitro-2-oxo-3H-pyridine-5-carboxylate
InChIKeyLAZDEVARJMTZEO-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(C(=O)N=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)