Products 1823324-55-5
CAS 1823324-55-5 is the registry number for Methyl 3-bromo-5-(bromomethyl)-2-fluorobenzoate, 98%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-bromo-5-(bromomethyl)-2-fluorobenzoate (CAS 1823324-55-5) is a chemical compound with the molecular formula C9H7Br2FO2 and a molecular weight of 325.96 g/mol. IUPAC name: methyl 3-bromo-5-(bromomethyl)-2-fluorobenzoate. InChIKey: PKXSJCYCZIZJMG-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2FO2 |
|---|---|
| Molecular weight | 325.96 g/mol |
| IUPAC name | methyl 3-bromo-5-(bromomethyl)-2-fluorobenzoate |
| InChIKey | PKXSJCYCZIZJMG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)CBr)Br)F |
Computed by PubChem (NCBI)