CAS 1823892-98-3 is the registry number for 2-(Trifluoromethyl)isonicotinamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(trifluoromethyl)pyridine-4-carboxamide (CAS 1823892-98-3) is a chemical compound with the molecular formula C7H5F3N2O and a molecular weight of 190.12 g/mol. IUPAC name: 2-(trifluoromethyl)pyridine-4-carboxamide. InChIKey: HVCLPIFLKCTDAB-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2-(trifluoromethyl)pyridine-4-carboxamide |
| InChIKey | HVCLPIFLKCTDAB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)