Products 182415-28-7

CAS 182415-28-7 is the registry number for 4-Bromo-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

4-bromo-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 182415-28-7) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: 4-bromo-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: FDRWGMORGBCDFM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BrN2O3
Molecular weight297.10 g/mol
IUPAC name4-bromo-3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyFDRWGMORGBCDFM-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=NNC(=C2Br)C(=O)O

Computed by PubChem (NCBI)