CAS 2089775-19-7 is the registry number for (S)-7-Fluoro-8-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-7-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 2089775-19-7) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: (3S)-7-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UCRUUDLUVUCOBY-QMMMGPOBSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | (3S)-7-fluoro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | UCRUUDLUVUCOBY-QMMMGPOBSA-N |
| SMILES | CC1=C(C=CC2=C1OC[C@H](C2)C(=O)O)F |
Computed by PubChem (NCBI)