Products 182747-75-7

CAS 182747-75-7 is the registry number for Methyl 6-hydroxy-1-benzofuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 6-hydroxy-1-benzofuran-2-carboxylate (CAS 182747-75-7) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 6-hydroxy-1-benzofuran-2-carboxylate. InChIKey: QWFLVOPCTQNVAN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O4
Molecular weight192.17 g/mol
IUPAC namemethyl 6-hydroxy-1-benzofuran-2-carboxylate
InChIKeyQWFLVOPCTQNVAN-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=C(O1)C=C(C=C2)O

Computed by PubChem (NCBI)