Products 183012-13-7
CAS 183012-13-7 is the registry number for YM116. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1H-imidazol-5-ylmethyl)-9H-carbazole (CAS 183012-13-7) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 2-(1H-imidazol-5-ylmethyl)-9H-carbazole. InChIKey: SHWQRVBJVFBWGP-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 2-(1H-imidazol-5-ylmethyl)-9H-carbazole |
| InChIKey | SHWQRVBJVFBWGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)CC4=CN=CN4 |
Computed by PubChem (NCBI)