CAS 183013-54-9 is the registry number for ethyl (2S)-4-oxotetrahydropyran-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl (2S)-4-oxooxane-2-carboxylate (CAS 183013-54-9) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: ethyl (2S)-4-oxooxane-2-carboxylate. InChIKey: MECFFZNWFZDTRY-ZETCQYMHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | ethyl (2S)-4-oxooxane-2-carboxylate |
| InChIKey | MECFFZNWFZDTRY-ZETCQYMHSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(=O)CCO1 |
Computed by PubChem (NCBI)