CAS 183241-73-8 appears in our catalog under these names: N-Lactoyl-L-Phenylalanine, N-Lactoyl-Phenylalanine, >95% (HPLC), Lactoyl Phenylalanine, N-Lactoyl-Phenylalanine/ 98.95% (existing batch purity), N-Lactoyl-phenylalanine. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 5mg, 1mg, 250mg.
(2S)-2-[[(2S)-2-hydroxypropanoyl]amino]-3-phenylpropanoic acid (CAS 183241-73-8) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-[[(2S)-2-hydroxypropanoyl]amino]-3-phenylpropanoic acid. InChIKey: IIRJJZHHNGABMQ-WPRPVWTQSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-hydroxypropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | IIRJJZHHNGABMQ-WPRPVWTQSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)O |
Computed by PubChem (NCBI)