CAS 1840966-95-1 appears in our catalog under these names: Sitagliptin Impurity 105, Sitagliptin Impurity 67, (E)-4-(2,4,5-Trifluorophenyl)but-2-enoic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g.
(E)-4-(2,4,5-trifluorophenyl)but-2-enoic acid (CAS 1840966-95-1) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: (E)-4-(2,4,5-trifluorophenyl)but-2-enoic acid. InChIKey: LTQSXIYFLNHNDE-HNQUOIGGSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | (E)-4-(2,4,5-trifluorophenyl)but-2-enoic acid |
| InChIKey | LTQSXIYFLNHNDE-HNQUOIGGSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C/C=C/C(=O)O |
Computed by PubChem (NCBI)