CAS 18512-30-6 appears in our catalog under these names: 1,3,6,8–Tetrahydroxynaphthalene, 1,3,6,8-Tetrahydroxynaphthalene/ 98.79% (existing batch purity), Naphthalene-1,3,6,8-tetraol, 98.96% ,, 98.96% ,, 1,3,6,8-Tetrahydroxynaphthalene, 98.35%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 2mg.
Naphthalene-1,3,6,8-tetrol (CAS 18512-30-6) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: naphthalene-1,3,6,8-tetrol. InChIKey: BCMKHWMDTMUUSI-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | naphthalene-1,3,6,8-tetrol |
| InChIKey | BCMKHWMDTMUUSI-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C=C(C2=C(C=C1O)O)O)O |
Computed by PubChem (NCBI)