CAS 309736-20-7 is the registry number for 2-(2-Formyl-1H-pyrrol-1-yl)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 309736-20-7) is a chemical compound with the molecular formula C14H13NO3S and a molecular weight of 275.32 g/mol. IUPAC name: 2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: RLHUXDYMGCWXPO-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3S |
|---|---|
| Molecular weight | 275.32 g/mol |
| IUPAC name | 2-(2-formylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| InChIKey | RLHUXDYMGCWXPO-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)N3C=CC=C3C=O)C(=O)O |
Computed by PubChem (NCBI)