CAS 185207-25-4 appears in our catalog under these names: 5-Methoxy-3-nitro-1,2-xylene, 95%, 5–Methoxy–1,2–dimethyl–3–nitrobenzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
5-methoxy-1,2-dimethyl-3-nitrobenzene (CAS 185207-25-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-methoxy-1,2-dimethyl-3-nitrobenzene. InChIKey: UZOJCEQCLYNEPS-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-methoxy-1,2-dimethyl-3-nitrobenzene |
| InChIKey | UZOJCEQCLYNEPS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)