CAS 185302-85-6 is the registry number for Methyl 3-(2,4-difluorophenyl)-3-oxopropanoate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-(2,4-difluorophenyl)-3-oxopropanoate (CAS 185302-85-6) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: methyl 3-(2,4-difluorophenyl)-3-oxopropanoate. InChIKey: SHYGKBSEUWXPBM-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | methyl 3-(2,4-difluorophenyl)-3-oxopropanoate |
| InChIKey | SHYGKBSEUWXPBM-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)