Products 185422-98-4
CAS 185422-98-4 appears in our catalog under these names: Methyl 2,6-dichloro-3-hydroxyisonicotinate, 98%, 98%, Methyl 2,6-dichloro-3-hydroxyisonicotinate, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,6-dichloro-3-hydroxypyridine-4-carboxylate (CAS 185422-98-4) is a chemical compound with the molecular formula C7H5Cl2NO3 and a molecular weight of 222.02 g/mol. IUPAC name: methyl 2,6-dichloro-3-hydroxypyridine-4-carboxylate. InChIKey: QQIPJTCWJOTXCU-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO3 |
|---|---|
| Molecular weight | 222.02 g/mol |
| IUPAC name | methyl 2,6-dichloro-3-hydroxypyridine-4-carboxylate |
| InChIKey | QQIPJTCWJOTXCU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC(=C1O)Cl)Cl |
Computed by PubChem (NCBI)