Products 185963-32-0
CAS 185963-32-0 appears in our catalog under these names: 3，5–Bis(aminomethyl)benzoic acid dihydrochloride, 3,5-Bis(aminomethyl)benzoic acid dihydrochloride, 97%, 97%, 3,5-Bis(aminomethyl)benzoic acid dihydrochloride, 95%, 3,5-Bis(aminomethyl)benzoic acid dihydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
3,5-bis(aminomethyl)benzoic acid;dihydrochloride (CAS 185963-32-0) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: 3,5-bis(aminomethyl)benzoic acid;dihydrochloride. InChIKey: BKJBHQXEYLPXTQ-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | 3,5-bis(aminomethyl)benzoic acid;dihydrochloride |
| InChIKey | BKJBHQXEYLPXTQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1CN)C(=O)O)CN.Cl.Cl |
Computed by PubChem (NCBI)