Products 186392-94-9
CAS 186392-94-9 is the registry number for 5,6-Dichloro-1H-indole-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5,6-dichloro-1H-indole-2-carboxylic acid (CAS 186392-94-9) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 5,6-dichloro-1H-indole-2-carboxylic acid. InChIKey: PITVZRMNFBGRFW-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5,6-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | PITVZRMNFBGRFW-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=CC(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)