CAS 1864015-04-2 appears in our catalog under these names: 5-(Chloromethyl)-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine hydrochloride, 95%, 5-(Chloromethyl)-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-(chloromethyl)-1,3-dimethylpyrazolo[5,4-b]pyridine;hydrochloride (CAS 1864015-04-2) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: 5-(chloromethyl)-1,3-dimethylpyrazolo[5,4-b]pyridine;hydrochloride. InChIKey: TUJMXDUVDXTBCY-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | 5-(chloromethyl)-1,3-dimethylpyrazolo[5,4-b]pyridine;hydrochloride |
| InChIKey | TUJMXDUVDXTBCY-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)CCl)C.Cl |
Computed by PubChem (NCBI)