Products 18664-39-6
CAS 18664-39-6 appears in our catalog under these names: 4–Cyanocinnamic Acid, 4-Cyanocinnamic acid, 3-(4-Cyanophenyl)-2-propenoic acid, 98%+(HPLC),RG, 98%+(HPLC),RG. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 50g, 25g, 100g, 250g, 500g, 250mg, 1g.
(E)-3-(4-cyanophenyl)prop-2-enoic acid (CAS 18664-39-6) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: (E)-3-(4-cyanophenyl)prop-2-enoic acid. InChIKey: USVZQKYCNGNRBV-AATRIKPKSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | (E)-3-(4-cyanophenyl)prop-2-enoic acid |
| InChIKey | USVZQKYCNGNRBV-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)C#N |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(4-cyanophenyl)prop-2-enoic acid, (2e)-3-(4-cyanophenyl)-2-propenoic acid, 4-Cyanocinnamic acid, (E)-3-(4-Cyanophenyl)acrylic acid, trans-4-Cyanocinnamic acid, 3-(4-cyanophenyl)acrylic acid, (E)-3-(4-cyanophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(4-cyanophenyl)-, (2E)-, 2-Propenoic acid, 3-(4-cyanophenyl)-, (E)-, (E)-3-(4-cyano-phenyl)-acrylic acid