Products 186706-80-9

CAS 186706-80-9 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3-mercaptopropanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid (CAS 186706-80-9) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid. InChIKey: ATVFTGTXIUDKIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO4S
Molecular weight221.28 g/mol
IUPAC name2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid
InChIKeyATVFTGTXIUDKIZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CS)C(=O)O

Computed by PubChem (NCBI)