CAS 20887-95-0 appears in our catalog under these names: N-Boc-L-Cysteine, 95%, Boc-L-cysteine, (R)–2–((tert–Butoxycarbonyl)amino)–3–mercaptopropanoic acid, Boc-L-Cys-OH, Boc-Cys-OH, >95.0%(HPLC)(T). Offered by: Fluorochem, TRC, GLPBio, Iris Biotech, TCI. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 2g, 50g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid (CAS 20887-95-0) is a chemical compound with the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid. InChIKey: ATVFTGTXIUDKIZ-YFKPBYRVSA-N.
| Molecular formula | C8H15NO4S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoic acid |
| InChIKey | ATVFTGTXIUDKIZ-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CS)C(=O)O |
Computed by PubChem (NCBI)