Products 1878-57-5
CAS 1878-57-5 appears in our catalog under these names: 2-(Biphenyl-3-yloxy)acetic acid, 95%, 2-(Biphenyl-3-yloxy)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-phenylphenoxy)acetic acid (CAS 1878-57-5) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-(3-phenylphenoxy)acetic acid. InChIKey: YOVGQDYNEVRBDW-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-(3-phenylphenoxy)acetic acid |
| InChIKey | YOVGQDYNEVRBDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(Biphenyl-3-yloxy)acetic acid, 2-([1,1'-Biphenyl]-3-yloxy)acetic acid, 2-(3-phenylphenoxy)acetic acid, m-phenylphenoxyacetic acid, 2-(Biphenyl-3-yloxy)aceticacid, ([1,1'-biphenyl]-3-yloxy)acetic acid, [([1,1'-Biphenyl]-3-yl)oxy]acetic acid, 2-([1,1 inverted exclamation marka-Biphenyl]-3-yloxy)acetic acid