Products 187835-15-0
CAS 187835-15-0 is the registry number for 4-(4-Chloro-2-methylphenyl)-1,2,3,6-tetrahydropyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(4-chloro-2-methylphenyl)-1,2,3,6-tetrahydropyridine (CAS 187835-15-0) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 4-(4-chloro-2-methylphenyl)-1,2,3,6-tetrahydropyridine. InChIKey: XGLSRMJNPQPWCV-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 4-(4-chloro-2-methylphenyl)-1,2,3,6-tetrahydropyridine |
| InChIKey | XGLSRMJNPQPWCV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C2=CCNCC2 |
Computed by PubChem (NCBI)