CAS 1879926-11-0 is the registry number for Sitagliptin Impurity 68. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-(2,4,5-trifluorophenyl)but-3-enoic acid (CAS 1879926-11-0) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 4-(2,4,5-trifluorophenyl)but-3-enoic acid. InChIKey: LOGLMTFFRYPVHZ-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 4-(2,4,5-trifluorophenyl)but-3-enoic acid |
| InChIKey | LOGLMTFFRYPVHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C=CCC(=O)O |
Computed by PubChem (NCBI)