CAS 886498-99-3 appears in our catalog under these names: 3-Fluoro-4-(trifluoromethoxy)benzyl alcohol, 98%, (3-Fluoro-4-(trifluoromethoxy)phenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
[3-fluoro-4-(trifluoromethoxy)phenyl]methanol (CAS 886498-99-3) is a chemical compound with the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. IUPAC name: [3-fluoro-4-(trifluoromethoxy)phenyl]methanol. InChIKey: YWURSIMNFATYRB-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O2 |
|---|---|
| Molecular weight | 210.13 g/mol |
| IUPAC name | [3-fluoro-4-(trifluoromethoxy)phenyl]methanol |
| InChIKey | YWURSIMNFATYRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)F)OC(F)(F)F |
Computed by PubChem (NCBI)