CAS 18818-64-9 is the registry number for Temazepam Acetate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl) acetate (CAS 18818-64-9) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: (7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl) acetate. InChIKey: PTWWAHZQIATUFG-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | (7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl) acetate |
| InChIKey | PTWWAHZQIATUFG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C(=O)N(C2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)