CAS 56116-67-7 is the registry number for 2-((4-Chlorophenyl)formamido)-3-(1H-indol-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid (CAS 56116-67-7) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: QJERBBQXOMUURJ-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | QJERBBQXOMUURJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)