CAS 39544-74-6 appears in our catalog under these names: Benzotript, Benzotript/ 99.7% (existing batch purity), (2S)-2-[(4-chlorophenyl)formamido]-3-(1H-indol-3-yl)propanoic acid, Benzotript, 95%. Offered by: TRC, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 500mg, 10mg, 1mg, 2mg, 5mg, 25mg, 50mg, 100mg.
(2S)-2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid (CAS 39544-74-6) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: (2S)-2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: QJERBBQXOMUURJ-INIZCTEOSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | (2S)-2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | QJERBBQXOMUURJ-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)