CAS 303034-29-9 is the registry number for 3-Chloro-4-((4-methoxyphenyl)amino)-1-(4-methylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-chloro-4-(4-methoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione (CAS 303034-29-9) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: 3-chloro-4-(4-methoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione. InChIKey: WLDXMRQKWLUXCI-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 3-chloro-4-(4-methoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione |
| InChIKey | WLDXMRQKWLUXCI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C(=C(C2=O)Cl)NC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)