CAS 5606-55-3 appears in our catalog under these names: Clorazepic Acid Ethyl Ester, ethyl 7–chloro–2,3–dihydro–2–oxo–5–phenyl–1H–1,4–benzodiazepine–3–carboxylate. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1g, 2,5g.
Ethyl 7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate (CAS 5606-55-3) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: ethyl 7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate. InChIKey: DTKOQJNQMOCKQU-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | ethyl 7-chloro-2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepine-3-carboxylate |
| InChIKey | DTKOQJNQMOCKQU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(=O)NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)