CAS 438473-17-7 is the registry number for 5-((2-Chlorophenoxy)methyl)-N-(pyridin-3-ylmethyl)furan-2-carboxamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg.
5-[(2-chlorophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide (CAS 438473-17-7) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: 5-[(2-chlorophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide. InChIKey: GCSVQQWPRWWDOG-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 5-[(2-chlorophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
| InChIKey | GCSVQQWPRWWDOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC=C(O2)C(=O)NCC3=CN=CC=C3)Cl |
Computed by PubChem (NCBI)