CAS 568543-95-3 is the registry number for 3-(4-Benzyl-7-chloro-3-oxo-3,4-dihydroquinoxalin-2-yl)propanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 10g.
3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoic acid (CAS 568543-95-3) is a chemical compound with the molecular formula C18H15ClN2O3 and a molecular weight of 342.8 g/mol. IUPAC name: 3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoic acid. InChIKey: RJPOKRWIBHUGTN-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O3 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 3-(4-benzyl-7-chloro-3-oxoquinoxalin-2-yl)propanoic acid |
| InChIKey | RJPOKRWIBHUGTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Cl)N=C(C2=O)CCC(=O)O |
Computed by PubChem (NCBI)