CAS 1882-70-8 appears in our catalog under these names: 2,3–diamino–2–methylpropanoic acid dihydrochloride, 5-Methoxyanthranilic acid hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 0,25g, 2,5g.
2-amino-5-methoxybenzoic acid;hydrochloride (CAS 1882-70-8) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: 2-amino-5-methoxybenzoic acid;hydrochloride. InChIKey: OZYJEEJZNNXJDU-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 2-amino-5-methoxybenzoic acid;hydrochloride |
| InChIKey | OZYJEEJZNNXJDU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)