Products 188526-10-5
CAS 188526-10-5 is the registry number for Benzyl 5-isopropyl-2-oxo-1,3-dioxole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylate (CAS 188526-10-5) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: benzyl 2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylate. InChIKey: RZCWVFWTLZQTSA-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | benzyl 2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylate |
| InChIKey | RZCWVFWTLZQTSA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(OC(=O)O1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)