CAS 1886967-78-7 appears in our catalog under these names: 3-(1,1-Difluoroethyl)bicyclo[1.1.1]pentane-1-carboxylic Acid, 97%, 97%, 3-(1,1-Difluoroethyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-(1,1-difluoroethyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1886967-78-7) is a chemical compound with the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. IUPAC name: 3-(1,1-difluoroethyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: WFODSJKTDGDWBD-UHFFFAOYSA-N.
| Molecular formula | C8H10F2O2 |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 3-(1,1-difluoroethyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | WFODSJKTDGDWBD-UHFFFAOYSA-N |
| SMILES | CC(C12CC(C1)(C2)C(=O)O)(F)F |
Computed by PubChem (NCBI)