Products 188797-88-8
CAS 188797-88-8 appears in our catalog under these names: 2-Phenyl-nicotinic acid methyl ester, 95%, Methyl 2–phenylnicotinate, Methyl 2-phenylnicotinate, 95+%, 95+%, Methyl 2-phenylnicotinate, 95+%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-phenylpyridine-3-carboxylate (CAS 188797-88-8) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 2-phenylpyridine-3-carboxylate. InChIKey: KWUIFNXSOUKTKE-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 2-phenylpyridine-3-carboxylate |
| InChIKey | KWUIFNXSOUKTKE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)