Products 1888335-48-5
CAS 1888335-48-5 appears in our catalog under these names: Norbornene–NHS, Norbornene-NHS, Norbornene-NHS, 92.08%, 1-(Bicyclo[2.2.1]hept-5-en-2-yloxy)-2,5. Offered by: GLPBio, Iris Biotech, MedChemExpress, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 25mg, 5g, 10 mg, 50 mg, 100 mg, 25 mg.
2-bicyclo[2.2.1]hept-5-enyl (2,5-dioxopyrrolidin-1-yl) carbonate (CAS 1888335-48-5) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 2-bicyclo[2.2.1]hept-5-enyl (2,5-dioxopyrrolidin-1-yl) carbonate. InChIKey: UFPOHRPAWSDIKK-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 2-bicyclo[2.2.1]hept-5-enyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| InChIKey | UFPOHRPAWSDIKK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)OC2CC3CC2C=C3 |
Computed by PubChem (NCBI)