CAS 188861-83-8 appears in our catalog under these names: Methyl 5-hydroxy-2-naphthoate, 97%, Methyl 5-hydroxynaphthalene-2-carboxylate, Methyl 5-hydroxy-2-naphthoate 97%, Methyl 5-hydroxy-2-naphthoate, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 25mg, 100mg, 250mg.
Methyl 5-hydroxynaphthalene-2-carboxylate (CAS 188861-83-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 5-hydroxynaphthalene-2-carboxylate. InChIKey: LENWVHZYLOZACS-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 5-hydroxynaphthalene-2-carboxylate |
| InChIKey | LENWVHZYLOZACS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=CC=C2)O |
Computed by PubChem (NCBI)