Products 1891124-53-0

CAS 1891124-53-0 is the registry number for 5-Bromo-2-oxoindoline-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromo-2-oxo-1,3-dihydroindole-6-carboxylic acid (CAS 1891124-53-0) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 5-bromo-2-oxo-1,3-dihydroindole-6-carboxylic acid. InChIKey: IAQKFTXYHAUECZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO3
Molecular weight256.05 g/mol
IUPAC name5-bromo-2-oxo-1,3-dihydroindole-6-carboxylic acid
InChIKeyIAQKFTXYHAUECZ-UHFFFAOYSA-N
SMILESC1C2=CC(=C(C=C2NC1=O)C(=O)O)Br

Computed by PubChem (NCBI)