CAS 1893085-69-2 is the registry number for 2–Chloro–4–(2–methylindol–3–yl)pyrimidine. Offered by: GLPBio. Available pack sizes: 100mg, 500mg.
3-(2-chloropyrimidin-4-yl)-2-methyl-1H-indole (CAS 1893085-69-2) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 3-(2-chloropyrimidin-4-yl)-2-methyl-1H-indole. InChIKey: ICNPQEMTBOYLQY-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 3-(2-chloropyrimidin-4-yl)-2-methyl-1H-indole |
| InChIKey | ICNPQEMTBOYLQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C3=NC(=NC=C3)Cl |
Computed by PubChem (NCBI)