Products 1894131-31-7
CAS 1894131-31-7 is the registry number for 4-Fluoro-2-(3-fluorophenyl)pyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-fluoro-2-(3-fluorophenyl)pyrrolidine;hydrochloride (CAS 1894131-31-7) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 4-fluoro-2-(3-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: ACMYUYBQIBDGIW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 4-fluoro-2-(3-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | ACMYUYBQIBDGIW-UHFFFAOYSA-N |
| SMILES | C1C(CNC1C2=CC(=CC=C2)F)F.Cl |
Computed by PubChem (NCBI)