Products 1894228-79-5
CAS 1894228-79-5 appears in our catalog under these names: 2-(2,2-Dimethyl-4-oxo-4H-1,3-dioxin-6-yl)acetic acid, 95%, 95%, 2-(2,2-Dimethyl-4-oxo-4H-1,3-dioxin-6-yl)acetic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetic acid (CAS 1894228-79-5) is a chemical compound with the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. IUPAC name: 2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetic acid. InChIKey: BYRLIEOLAXRECG-UHFFFAOYSA-N.
| Molecular formula | C8H10O5 |
|---|---|
| Molecular weight | 186.16 g/mol |
| IUPAC name | 2-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)acetic acid |
| InChIKey | BYRLIEOLAXRECG-UHFFFAOYSA-N |
| SMILES | CC1(OC(=CC(=O)O1)CC(=O)O)C |
Computed by PubChem (NCBI)