CAS 189574-20-7 is the registry number for HOR1-C59. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R,5R)-4-N,5-N-dibenzyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide (CAS 189574-20-7) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: (4R,5R)-4-N,5-N-dibenzyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide. InChIKey: BGPXLBACWHVXTA-QZTJIDSGSA-N.
| Molecular formula | C21H24N2O4 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (4R,5R)-4-N,5-N-dibenzyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
| InChIKey | BGPXLBACWHVXTA-QZTJIDSGSA-N |
| SMILES | CC1(O[C@H]([C@@H](O1)C(=O)NCC2=CC=CC=C2)C(=O)NCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)