CAS 1895984-82-3 is the registry number for 5-Amino-1,3-dihydro-4-methoxy-2H-indol-2-one. Offered by: TRC. Available pack sizes: 100mg.
5-amino-4-methoxy-1,3-dihydroindol-2-one (CAS 1895984-82-3) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 5-amino-4-methoxy-1,3-dihydroindol-2-one. InChIKey: OZHGRHKTGPSLIQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 5-amino-4-methoxy-1,3-dihydroindol-2-one |
| InChIKey | OZHGRHKTGPSLIQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1CC(=O)N2)N |
Computed by PubChem (NCBI)